C11H11IN5O4PS2 — CID 142468607
(2E)-2-iodophosphanyloxyimino-3-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 142468607) has the molecular formula C11H11IN5O4PS2 and a molecular weight of 499.25 g/mol. Its IUPAC name is (2E)-2-iodophosphanyloxyimino-3-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2E)-2-iodophosphanyloxyimino-3-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 142468607 |
| Molecular Formula | C11H11IN5O4PS2 |
| Molecular Weight | 499.25 g/mol |
| Exact Mass | 498.90 |
| IUPAC Name | (2E)-2-iodophosphanyloxyimino-3-phenyl-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)/C(Cc2ccccc2)=N/OPI)s1 |
| InChI | InChI=1S/C11H11IN5O4PS2/c12-22-21-17-8(6-7-4-2-1-3-5-7)9(18)14-10-15-16-11(23-10)24(13,19)20/h1-5,22H,6H2,(H2,13,19,20)(H,14,15,18)/b17-8+ |
| InChIKey | KZPJDPSXNAMKQA-CAOOACKPSA-N |
| XLogP | 1.68 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|