C21H15N3O — CID 13297593
(2,5-diphenyltriazol-4-yl)-phenylmethanone (PubChem CID 13297593) has the molecular formula C21H15N3O and a molecular weight of 325.37 g/mol. Its IUPAC name is (2,5-diphenyltriazol-4-yl)-phenylmethanone.
| Compound Name | (2,5-diphenyltriazol-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 13297593 |
| Molecular Formula | C21H15N3O |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2,5-diphenyltriazol-4-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1nn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H15N3O/c25-21(17-12-6-2-7-13-17)20-19(16-10-4-1-5-11-16)22-24(23-20)18-14-8-3-9-15-18/h1-15H |
| InChIKey | WKVSCWZXWYDTLC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |