C28H22N2Se — CID 146162067
4-(4-methylphenyl)selanyl-1,3,5-triphenylpyrazole (PubChem CID 146162067) has the molecular formula C28H22N2Se and a molecular weight of 465.46 g/mol. Its IUPAC name is 4-(4-methylphenyl)selanyl-1,3,5-triphenylpyrazole.
| Compound Name | 4-(4-methylphenyl)selanyl-1,3,5-triphenylpyrazole |
|---|---|
| PubChem CID | 146162067 |
| Molecular Formula | C28H22N2Se |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 4-(4-methylphenyl)selanyl-1,3,5-triphenylpyrazole |
| SMILES | Cc1ccc([Se]c2c(-c3ccccc3)nn(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2Se/c1-21-17-19-25(20-18-21)31-28-26(22-11-5-2-6-12-22)29-30(24-15-9-4-10-16-24)27(28)23-13-7-3-8-14-23/h2-20H,1H3 |
| InChIKey | ZAZXDOBMTSZKOK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|