C27H19ClN2Se — CID 146162070
3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole (PubChem CID 146162070) has the molecular formula C27H19ClN2Se and a molecular weight of 485.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole.
| Compound Name | 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole |
|---|---|
| PubChem CID | 146162070 |
| Molecular Formula | C27H19ClN2Se |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole |
| SMILES | Clc1ccc(-c2nn(-c3ccccc3)c(-c3ccccc3)c2[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19ClN2Se/c28-22-18-16-20(17-19-22)25-27(31-24-14-8-3-9-15-24)26(21-10-4-1-5-11-21)30(29-25)23-12-6-2-7-13-23/h1-19H |
| InChIKey | YUCBSLLJLROXRX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|