About 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole
3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole (PubChem CID 146162070) has the molecular formula C27H19ClN2Se
and a molecular weight of 485.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole |
| PubChem CID | 146162070 |
| Molecular Formula | C27H19ClN2Se |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole |
| SMILES | Clc1ccc(-c2nn(-c3ccccc3)c(-c3ccccc3)c2[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19ClN2Se/c28-22-18-16-20(17-19-22)25-27(31-24-14-8-3-9-15-24)26(21-10-4-1-5-11-21)30(29-25)23-12-6-2-7-13-23/h1-19H |
| InChIKey | YUCBSLLJLROXRX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole?
The IUPAC name of 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole (CID 146162070) is 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole.
What is the SMILES notation for 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole?
The canonical SMILES for 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole is Clc1ccc(-c2nn(-c3ccccc3)c(-c3ccccc3)c2[Se]c2ccccc2)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole?
The InChIKey is YUCBSLLJLROXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19ClN2Se/c28-22-18-16-20(17-19-22)25-27(31-24-14-8-3-9-15-24)26(21-10-4-1-5-11-21)30(29-25)23-12-6-2-7-13-23/h1-19H.
What are the key properties of 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole?
3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole has a molecular weight of 485.88 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1,5-diphenyl-4-phenylselanylpyrazole is sourced from PubChem (CID 146162070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).