C17H15ClN2Se — CID 156773487
1-(4-chlorophenyl)-3,5-dimethyl-4-phenylselanylpyrazole (PubChem CID 156773487) has the molecular formula C17H15ClN2Se and a molecular weight of 361.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,5-dimethyl-4-phenylselanylpyrazole.
| Compound Name | 1-(4-chlorophenyl)-3,5-dimethyl-4-phenylselanylpyrazole |
|---|---|
| PubChem CID | 156773487 |
| Molecular Formula | C17H15ClN2Se |
| Molecular Weight | 361.73 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3,5-dimethyl-4-phenylselanylpyrazole |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(C)c1[Se]c1ccccc1 |
| InChI | InChI=1S/C17H15ClN2Se/c1-12-17(21-16-6-4-3-5-7-16)13(2)20(19-12)15-10-8-14(18)9-11-15/h3-11H,1-2H3 |
| InChIKey | BVYOKFJVLJKWOV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|