C20H19ClN2O2 — CID 101421740
3-(4-chlorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanoic acid (PubChem CID 101421740) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 101421740 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)propanoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-13-20(14(2)23(22-13)17-6-4-3-5-7-17)18(12-19(24)25)15-8-10-16(21)11-9-15/h3-11,18H,12H2,1-2H3,(H,24,25) |
| InChIKey | YVZQESWPYSMIFT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |