C35H42Cl2N6O — CID 175281612
2,4-bis[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]-1,5-dipyrrolidin-1-ylpentan-3-one (PubChem CID 175281612) has the molecular formula C35H42Cl2N6O and a molecular weight of 633.67 g/mol. Its IUPAC name is 2,4-bis[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]-1,5-dipyrrolidin-1-ylpentan-3-one.
| Compound Name | 2,4-bis[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]-1,5-dipyrrolidin-1-ylpentan-3-one |
|---|---|
| PubChem CID | 175281612 |
| Molecular Formula | C35H42Cl2N6O |
| Molecular Weight | 633.67 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 2,4-bis[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]-1,5-dipyrrolidin-1-ylpentan-3-one |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(C)c1C(CN1CCCC1)C(=O)C(CN1CCCC1)c1c(C)nn(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C35H42Cl2N6O/c1-23-33(25(3)42(38-23)29-13-9-27(36)10-14-29)31(21-40-17-5-6-18-40)35(44)32(22-41-19-7-8-20-41)34-24(2)39-43(26(34)4)30-15-11-28(37)12-16-30/h9-16,31-32H,5-8,17-22H2,1-4H3 |
| InChIKey | KLCVHHXUJODUFH-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |