C25H18INO2 — CID 132560330
(5-iodo-2,4-diphenyl-3-pyridinyl)-(4-methoxyphenyl)methanone (PubChem CID 132560330) has the molecular formula C25H18INO2 and a molecular weight of 491.33 g/mol. Its IUPAC name is (5-iodo-2,4-diphenyl-3-pyridinyl)-(4-methoxyphenyl)methanone.
| Compound Name | (5-iodo-2,4-diphenyl-3-pyridinyl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 132560330 |
| Molecular Formula | C25H18INO2 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | (5-iodo-2,4-diphenyl-3-pyridinyl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(-c3ccccc3)ncc(I)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18INO2/c1-29-20-14-12-19(13-15-20)25(28)23-22(17-8-4-2-5-9-17)21(26)16-27-24(23)18-10-6-3-7-11-18/h2-16H,1H3 |
| InChIKey | CQNCSXHYAIEKTI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|