C9H7N2O2S3+ — CID 10089745
methyl-[3-(4-nitrophenyl)-1,4,2-dithiazol-5-ylidene]sulfanium (PubChem CID 10089745) has the molecular formula C9H7N2O2S3+ and a molecular weight of 271.37 g/mol. Its IUPAC name is methyl-[3-(4-nitrophenyl)-1,4,2-dithiazol-5-ylidene]sulfanium.
| Compound Name | methyl-[3-(4-nitrophenyl)-1,4,2-dithiazol-5-ylidene]sulfanium |
|---|---|
| PubChem CID | 10089745 |
| Molecular Formula | C9H7N2O2S3+ |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | methyl-[3-(4-nitrophenyl)-1,4,2-dithiazol-5-ylidene]sulfanium |
| SMILES | C/[S+]=c1\snc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C9H7N2O2S3/c1-14-9-15-8(10-16-9)6-2-4-7(5-3-6)11(12)13/h2-5H,1H3/q+1 |
| InChIKey | SZBVMMIYAZMVEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|