C9H8N6O2S — CID 14140345
2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine (PubChem CID 14140345) has the molecular formula C9H8N6O2S and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
| Compound Name | 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 14140345 |
| Molecular Formula | C9H8N6O2S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C9H8N6O2S/c10-8(11)12-9-14-13-7(18-9)5-1-3-6(4-2-5)15(16)17/h1-4H,(H4,10,11,12,14) |
| InChIKey | UURJTGKKVSDSGI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|