About 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine
2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine (PubChem CID 14140345) has the molecular formula C9H8N6O2S
and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| PubChem CID | 14140345 |
| Molecular Formula | C9H8N6O2S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C9H8N6O2S/c10-8(11)12-9-14-13-7(18-9)5-1-3-6(4-2-5)15(16)17/h1-4H,(H4,10,11,12,14) |
| InChIKey | UURJTGKKVSDSGI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The IUPAC name of 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine (CID 14140345) is 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
What is the SMILES notation for 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The canonical SMILES for 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine is NC(N)=Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1.
What is the InChIKey of 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The InChIKey is UURJTGKKVSDSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6O2S/c10-8(11)12-9-14-13-7(18-9)5-1-3-6(4-2-5)15(16)17/h1-4H,(H4,10,11,12,14).
What are the key properties of 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine has a molecular weight of 264.27 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]guanidine is sourced from PubChem (CID 14140345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).