C10H7N3O4S — CID 66826514
amino 2-(4-nitrophenyl)-1,3-thiazole-5-carboxylate (PubChem CID 66826514) has the molecular formula C10H7N3O4S and a molecular weight of 265.25 g/mol. Its IUPAC name is amino 2-(4-nitrophenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | amino 2-(4-nitrophenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 66826514 |
| Molecular Formula | C10H7N3O4S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | amino 2-(4-nitrophenyl)-1,3-thiazole-5-carboxylate |
| SMILES | NOC(=O)c1cnc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C10H7N3O4S/c11-17-10(14)8-5-12-9(18-8)6-1-3-7(4-2-6)13(15)16/h1-5H,11H2 |
| InChIKey | QUWFNKPSBRPIMK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|