C18H19N7O3S — CID 53252159
N-[1-amino-3-(4-nitrophenyl)propan-2-yl]-2-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazole-5-carboxamide (PubChem CID 53252159) has the molecular formula C18H19N7O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[1-amino-3-(4-nitrophenyl)propan-2-yl]-2-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-amino-3-(4-nitrophenyl)propan-2-yl]-2-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 53252159 |
| Molecular Formula | C18H19N7O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[1-amino-3-(4-nitrophenyl)propan-2-yl]-2-[2-(methylamino)pyrimidin-4-yl]-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nccc(-c2ncc(C(=O)NC(CN)Cc3ccc([N+](=O)[O-])cc3)s2)n1 |
| InChI | InChI=1S/C18H19N7O3S/c1-20-18-21-7-6-14(24-18)17-22-10-15(29-17)16(26)23-12(9-19)8-11-2-4-13(5-3-11)25(27)28/h2-7,10,12H,8-9,19H2,1H3,(H,23,26)(H,20,21,24) |
| InChIKey | IFSMCSIPGIZUCV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|