C15H19N3O2S2 — CID 10616936
2-tert-butylimino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine (PubChem CID 10616936) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-tert-butylimino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine.
| Compound Name | 2-tert-butylimino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine |
|---|---|
| PubChem CID | 10616936 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-tert-butylimino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine |
| SMILES | CN(C)c1s/c(=N\C(C)(C)C)sc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-15(2,3)16-14-21-12(13(22-14)17(4)5)10-6-8-11(9-7-10)18(19)20/h6-9H,1-5H3/b16-14- |
| InChIKey | VRNQBBANIKSEGD-PEZBUJJGSA-N |
| XLogP | 4.15 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|