C26H20N4O4S4 — CID 147109631
N,N-dimethyl-7-[5-[5-[5-[(4-nitrophenyl)diazenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-amine (PubChem CID 147109631) has the molecular formula C26H20N4O4S4 and a molecular weight of 580.74 g/mol. Its IUPAC name is N,N-dimethyl-7-[5-[5-[5-[(4-nitrophenyl)diazenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-amine.
| Compound Name | N,N-dimethyl-7-[5-[5-[5-[(4-nitrophenyl)diazenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-amine |
|---|---|
| PubChem CID | 147109631 |
| Molecular Formula | C26H20N4O4S4 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | N,N-dimethyl-7-[5-[5-[5-[(4-nitrophenyl)diazenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-amine |
| SMILES | CN(C)c1sc(-c2ccc(-c3ccc(-c4ccc(/N=N/c5ccc([N+](=O)[O-])cc5)s4)s3)s2)c2c1OCCO2 |
| InChI | InChI=1S/C26H20N4O4S4/c1-29(2)26-24-23(33-13-14-34-24)25(38-26)21-10-9-18(36-21)17-7-8-19(35-17)20-11-12-22(37-20)28-27-15-3-5-16(6-4-15)30(31)32/h3-12H,13-14H2,1-2H3/b28-27+ |
| InChIKey | BMGDNRSEDDWRCA-BYYHNAKLSA-N |
| XLogP | 9.09 |
| TPSA | 89.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|