About (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene
(4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene (PubChem CID 22625442) has the molecular formula C50H39N5O2
and a molecular weight of 741.90 g/mol. Its IUPAC name is (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene.
Molecular Properties
| Compound Name | (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene |
| PubChem CID | 22625442 |
| Molecular Formula | C50H39N5O2 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.31 |
| IUPAC Name | (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene |
| SMILES | O=[N+]([O-])c1ccc(/N=N/C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc(/N=N/C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19N3O2.C25H20N2/c29-28(30)24-18-16-23(17-19-24)26-27-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)27-26-24-19-11-4-12-20-24/h1-19H;1-20H/b2*27-26+ |
| InChIKey | URQLVUGJCBEEMK-MSOIYACKSA-N |
| XLogP | 13.43 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene?
The IUPAC name of (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene (CID 22625442) is (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene.
What is the SMILES notation for (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene?
The canonical SMILES for (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene is O=[N+]([O-])c1ccc(/N=N/C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc(/N=N/C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene?
The InChIKey is URQLVUGJCBEEMK-MSOIYACKSA-N. The full InChI is InChI=1S/C25H19N3O2.C25H20N2/c29-28(30)24-18-16-23(17-19-24)26-27-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)27-26-24-19-11-4-12-20-24/h1-19H;1-20H/b2*27-26+.
What are the key properties of (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene?
(4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene has a molecular weight of 741.90 g/mol, XLogP of 13.43, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-trityldiazene;phenyl(trityl)diazene is sourced from PubChem (CID 22625442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).