C20H16N6O6 — CID 108542164
N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 108542164) has the molecular formula C20H16N6O6 and a molecular weight of 436.38 g/mol. Its IUPAC name is N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 108542164 |
| Molecular Formula | C20H16N6O6 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCCNC(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C20H16N6O6/c27-17(9-25-19(29)13-3-2-12(26(31)32)8-14(13)20(25)30)21-5-6-22-18(28)11-1-4-15-16(7-11)24-10-23-15/h1-4,7-8,10H,5-6,9H2,(H,21,27)(H,22,28)(H,23,24) |
| InChIKey | ZGSPFUXZCOSNML-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 167.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|