C21H21N5O6 — CID 108542718
4-(dimethylamino)-N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]benzamide (PubChem CID 108542718) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108542718 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-(dimethylamino)-N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)NCCNC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C21H21N5O6/c1-24(2)14-5-3-13(4-6-14)19(28)23-10-9-22-18(27)12-25-20(29)16-8-7-15(26(31)32)11-17(16)21(25)30/h3-8,11H,9-10,12H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | IKGSHIHMUOETDW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|