About [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate
[2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate (PubChem CID 7742643) has the molecular formula C22H15ClO5
and a molecular weight of 394.81 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate |
| PubChem CID | 7742643 |
| Molecular Formula | C22H15ClO5 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate |
| SMILES | Cc1cc2oc(-c3ccccc3Cl)c(OC(=O)c3ccco3)c(=O)c2cc1C |
| InChI | InChI=1S/C22H15ClO5/c1-12-10-15-18(11-13(12)2)27-20(14-6-3-4-7-16(14)23)21(19(15)24)28-22(25)17-8-5-9-26-17/h3-11H,1-2H3 |
| InChIKey | CKCOOXOYCLYYBY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate?
The IUPAC name of [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate (CID 7742643) is [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate.
What is the SMILES notation for [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate?
The canonical SMILES for [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate is Cc1cc2oc(-c3ccccc3Cl)c(OC(=O)c3ccco3)c(=O)c2cc1C.
What is the InChIKey of [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate?
The InChIKey is CKCOOXOYCLYYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClO5/c1-12-10-15-18(11-13(12)2)27-20(14-6-3-4-7-16(14)23)21(19(15)24)28-22(25)17-8-5-9-26-17/h3-11H,1-2H3.
What are the key properties of [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate?
[2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate has a molecular weight of 394.81 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-6,7-dimethyl-4-oxochromen-3-yl] furan-2-carboxylate is sourced from PubChem (CID 7742643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).