C24H22O3 — CID 11428312
2-(3,4-dimethoxyphenyl)-5,6-dimethyl-3-phenyl-1-benzofuran (PubChem CID 11428312) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,6-dimethyl-3-phenyl-1-benzofuran.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,6-dimethyl-3-phenyl-1-benzofuran |
|---|---|
| PubChem CID | 11428312 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,6-dimethyl-3-phenyl-1-benzofuran |
| SMILES | COc1ccc(-c2oc3cc(C)c(C)cc3c2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H22O3/c1-15-12-19-21(13-16(15)2)27-24(23(19)17-8-6-5-7-9-17)18-10-11-20(25-3)22(14-18)26-4/h5-14H,1-4H3 |
| InChIKey | HBZDBUVJAWMAKJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |