C25H20O4 — CID 12689147
1-(5-methoxy-2,3-diphenyl-1-benzofuran-6-yl)butane-1,3-dione (PubChem CID 12689147) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-(5-methoxy-2,3-diphenyl-1-benzofuran-6-yl)butane-1,3-dione.
| Compound Name | 1-(5-methoxy-2,3-diphenyl-1-benzofuran-6-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 12689147 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-(5-methoxy-2,3-diphenyl-1-benzofuran-6-yl)butane-1,3-dione |
| SMILES | COc1cc2c(-c3ccccc3)c(-c3ccccc3)oc2cc1C(=O)CC(C)=O |
| InChI | InChI=1S/C25H20O4/c1-16(26)13-21(27)19-14-23-20(15-22(19)28-2)24(17-9-5-3-6-10-17)25(29-23)18-11-7-4-8-12-18/h3-12,14-15H,13H2,1-2H3 |
| InChIKey | FCEJAGDAFVOTBU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|