C30H26O5 — CID 102296681
2-phenyl-5-phenylmethoxy-3-(3,4,5-trimethoxyphenyl)-1-benzofuran (PubChem CID 102296681) has the molecular formula C30H26O5 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-phenyl-5-phenylmethoxy-3-(3,4,5-trimethoxyphenyl)-1-benzofuran.
| Compound Name | 2-phenyl-5-phenylmethoxy-3-(3,4,5-trimethoxyphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 102296681 |
| Molecular Formula | C30H26O5 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-phenyl-5-phenylmethoxy-3-(3,4,5-trimethoxyphenyl)-1-benzofuran |
| SMILES | COc1cc(-c2c(-c3ccccc3)oc3ccc(OCc4ccccc4)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C30H26O5/c1-31-26-16-22(17-27(32-2)30(26)33-3)28-24-18-23(34-19-20-10-6-4-7-11-20)14-15-25(24)35-29(28)21-12-8-5-9-13-21/h4-18H,19H2,1-3H3 |
| InChIKey | XCCASTKHUBNFLW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |