C17H13IO4 — CID 11718442
3-iodo-6,7-dimethoxy-2-phenylchromen-4-one (PubChem CID 11718442) has the molecular formula C17H13IO4 and a molecular weight of 408.19 g/mol. Its IUPAC name is 3-iodo-6,7-dimethoxy-2-phenylchromen-4-one.
| Compound Name | 3-iodo-6,7-dimethoxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 11718442 |
| Molecular Formula | C17H13IO4 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 3-iodo-6,7-dimethoxy-2-phenylchromen-4-one |
| SMILES | COc1cc2oc(-c3ccccc3)c(I)c(=O)c2cc1OC |
| InChI | InChI=1S/C17H13IO4/c1-20-13-8-11-12(9-14(13)21-2)22-17(15(18)16(11)19)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | YPLAEYQNRFSECH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|