C25H20O4 — CID 10905103
3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-phenylchromen-4-one (PubChem CID 10905103) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is 3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-phenylchromen-4-one.
| Compound Name | 3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 10905103 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2-phenylchromen-4-one |
| SMILES | COc1ccc(/C=C/c2c(-c3ccccc3)oc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C25H20O4/c1-27-22-15-13-17(16-23(22)28-2)12-14-20-24(26)19-10-6-7-11-21(19)29-25(20)18-8-4-3-5-9-18/h3-16H,1-2H3/b14-12+ |
| InChIKey | YSSUZQVCWJVROM-WYMLVPIESA-N |
| XLogP | 5.65 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |