C19H16O8 — CID 70411870
(5,6,7-trimethoxy-4-oxo-2-phenylchromen-3-yl) hydrogen carbonate (PubChem CID 70411870) has the molecular formula C19H16O8 and a molecular weight of 372.33 g/mol. Its IUPAC name is (5,6,7-trimethoxy-4-oxo-2-phenylchromen-3-yl) hydrogen carbonate.
| Compound Name | (5,6,7-trimethoxy-4-oxo-2-phenylchromen-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70411870 |
| Molecular Formula | C19H16O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (5,6,7-trimethoxy-4-oxo-2-phenylchromen-3-yl) hydrogen carbonate |
| SMILES | COc1cc2oc(-c3ccccc3)c(OC(=O)O)c(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C19H16O8/c1-23-12-9-11-13(17(25-3)16(12)24-2)14(20)18(27-19(21)22)15(26-11)10-7-5-4-6-8-10/h4-9H,1-3H3,(H,21,22) |
| InChIKey | SFDTWGRQEVIYRF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |