C19H18O5 — CID 102581922
5,6,7-trimethoxy-4-methyl-3-phenylisochromen-1-one (PubChem CID 102581922) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5,6,7-trimethoxy-4-methyl-3-phenylisochromen-1-one.
| Compound Name | 5,6,7-trimethoxy-4-methyl-3-phenylisochromen-1-one |
|---|---|
| PubChem CID | 102581922 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5,6,7-trimethoxy-4-methyl-3-phenylisochromen-1-one |
| SMILES | COc1cc2c(=O)oc(-c3ccccc3)c(C)c2c(OC)c1OC |
| InChI | InChI=1S/C19H18O5/c1-11-15-13(10-14(21-2)17(22-3)18(15)23-4)19(20)24-16(11)12-8-6-5-7-9-12/h5-10H,1-4H3 |
| InChIKey | WVKQYBUEHCZQQJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |