C25H20O3S — CID 67617880
5-(2-methoxyphenyl)sulfanyl-3-methyl-4,6-diphenylpyran-2-one (PubChem CID 67617880) has the molecular formula C25H20O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)sulfanyl-3-methyl-4,6-diphenylpyran-2-one.
| Compound Name | 5-(2-methoxyphenyl)sulfanyl-3-methyl-4,6-diphenylpyran-2-one |
|---|---|
| PubChem CID | 67617880 |
| Molecular Formula | C25H20O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-(2-methoxyphenyl)sulfanyl-3-methyl-4,6-diphenylpyran-2-one |
| SMILES | COc1ccccc1Sc1c(-c2ccccc2)oc(=O)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H20O3S/c1-17-22(18-11-5-3-6-12-18)24(29-21-16-10-9-15-20(21)27-2)23(28-25(17)26)19-13-7-4-8-14-19/h3-16H,1-2H3 |
| InChIKey | KTTOWAHNFIZHIQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |