C11H10N2O3S — CID 11096993
4-hydroxy-5-(2-methoxyphenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 11096993) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-hydroxy-5-(2-methoxyphenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-(2-methoxyphenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 11096993 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4-hydroxy-5-(2-methoxyphenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | COc1ccccc1Sc1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C11H10N2O3S/c1-16-7-4-2-3-5-8(7)17-9-10(14)12-6-13-11(9)15/h2-6H,1H3,(H2,12,13,14,15) |
| InChIKey | YDUAOJPPBAUYDZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |