C17H22N2O3 — CID 73333273
5-butyl-2-(3,4,5-trimethoxyphenyl)pyrimidine (PubChem CID 73333273) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-butyl-2-(3,4,5-trimethoxyphenyl)pyrimidine.
| Compound Name | 5-butyl-2-(3,4,5-trimethoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 73333273 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-butyl-2-(3,4,5-trimethoxyphenyl)pyrimidine |
| SMILES | CCCCc1cnc(-c2cc(OC)c(OC)c(OC)c2)nc1 |
| InChI | InChI=1S/C17H22N2O3/c1-5-6-7-12-10-18-17(19-11-12)13-8-14(20-2)16(22-4)15(9-13)21-3/h8-11H,5-7H2,1-4H3 |
| InChIKey | ZJNJRQJKDYOJGJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |