C28H37N3O5 — CID 164861216
3,7-dihydroxy-8-methoxy-2-[4-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]butyl]phenyl]chromen-4-one (PubChem CID 164861216) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3,7-dihydroxy-8-methoxy-2-[4-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]butyl]phenyl]chromen-4-one.
| Compound Name | 3,7-dihydroxy-8-methoxy-2-[4-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]butyl]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 164861216 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 3,7-dihydroxy-8-methoxy-2-[4-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]butyl]phenyl]chromen-4-one |
| SMILES | COc1c(O)ccc2c(=O)c(O)c(-c3ccc(CCCCN(C)CCN4CCN(C)CC4)cc3)oc12 |
| InChI | InChI=1S/C28H37N3O5/c1-29(14-17-31-18-15-30(2)16-19-31)13-5-4-6-20-7-9-21(10-8-20)26-25(34)24(33)22-11-12-23(32)28(35-3)27(22)36-26/h7-12,32,34H,4-6,13-19H2,1-3H3 |
| InChIKey | OHRQUJBQHLSGIT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|