C24H28N2O4 — CID 164861295
7-hydroxy-8-methoxy-2-[4-[methyl(2-piperidin-1-ylethyl)amino]phenyl]chromen-4-one (PubChem CID 164861295) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 7-hydroxy-8-methoxy-2-[4-[methyl(2-piperidin-1-ylethyl)amino]phenyl]chromen-4-one.
| Compound Name | 7-hydroxy-8-methoxy-2-[4-[methyl(2-piperidin-1-ylethyl)amino]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 164861295 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 7-hydroxy-8-methoxy-2-[4-[methyl(2-piperidin-1-ylethyl)amino]phenyl]chromen-4-one |
| SMILES | COc1c(O)ccc2c(=O)cc(-c3ccc(N(C)CCN4CCCCC4)cc3)oc12 |
| InChI | InChI=1S/C24H28N2O4/c1-25(14-15-26-12-4-3-5-13-26)18-8-6-17(7-9-18)22-16-21(28)19-10-11-20(27)24(29-2)23(19)30-22/h6-11,16,27H,3-5,12-15H2,1-2H3 |
| InChIKey | XLUUFCWKVUHHDO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |