C24H31N3O5 — CID 164861194
2-[4-[[3-(4-aminobutylamino)propylamino]methyl]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one (PubChem CID 164861194) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[4-[[3-(4-aminobutylamino)propylamino]methyl]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one.
| Compound Name | 2-[4-[[3-(4-aminobutylamino)propylamino]methyl]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one |
|---|---|
| PubChem CID | 164861194 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-[4-[[3-(4-aminobutylamino)propylamino]methyl]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one |
| SMILES | COc1c(O)ccc2c(=O)c(O)c(-c3ccc(CNCCCNCCCCN)cc3)oc12 |
| InChI | InChI=1S/C24H31N3O5/c1-31-24-19(28)10-9-18-20(29)21(30)22(32-23(18)24)17-7-5-16(6-8-17)15-27-14-4-13-26-12-3-2-11-25/h5-10,26-28,30H,2-4,11-15,25H2,1H3 |
| InChIKey | DNXLUDOUFITNRN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|