C26H29F3N2O5 — CID 72714780
5-hydroxy-8-methoxy-7-[4-(4-methylpiperazin-1-yl)butoxy]-2-[4-(trifluoromethyl)phenyl]chromen-4-one (PubChem CID 72714780) has the molecular formula C26H29F3N2O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is 5-hydroxy-8-methoxy-7-[4-(4-methylpiperazin-1-yl)butoxy]-2-[4-(trifluoromethyl)phenyl]chromen-4-one.
| Compound Name | 5-hydroxy-8-methoxy-7-[4-(4-methylpiperazin-1-yl)butoxy]-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 72714780 |
| Molecular Formula | C26H29F3N2O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 5-hydroxy-8-methoxy-7-[4-(4-methylpiperazin-1-yl)butoxy]-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
| SMILES | COc1c(OCCCCN2CCN(C)CC2)cc(O)c2c(=O)cc(-c3ccc(C(F)(F)F)cc3)oc12 |
| InChI | InChI=1S/C26H29F3N2O5/c1-30-10-12-31(13-11-30)9-3-4-14-35-22-16-20(33)23-19(32)15-21(36-25(23)24(22)34-2)17-5-7-18(8-6-17)26(27,28)29/h5-8,15-16,33H,3-4,9-14H2,1-2H3 |
| InChIKey | MAGPJQPAUUDKLT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|