C21H21NO4 — CID 153398880
3-deuterio-8-hydroxy-7-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one (PubChem CID 153398880) has the molecular formula C21H21NO4 and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-deuterio-8-hydroxy-7-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one.
| Compound Name | 3-deuterio-8-hydroxy-7-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 153398880 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-deuterio-8-hydroxy-7-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one |
| SMILES | [2H]c1c(-c2ccc(N3CCCCC3)cc2)oc2c(O)c(OC)ccc2c1=O |
| InChI | InChI=1S/C21H21NO4/c1-25-18-10-9-16-17(23)13-19(26-21(16)20(18)24)14-5-7-15(8-6-14)22-11-3-2-4-12-22/h5-10,13,24H,2-4,11-12H2,1H3/i13D |
| InChIKey | KLCDSCGWKBEIBV-YSOHJTORSA-N |
| XLogP | 4.16 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |