About 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one
6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one (PubChem CID 71765113) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one |
| PubChem CID | 71765113 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3cc(N4CCCNCC4)ccc3o2)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-26-20-6-4-15(12-22(20)27-2)21-14-18(25)17-13-16(5-7-19(17)28-21)24-10-3-8-23-9-11-24/h4-7,12-14,23H,3,8-11H2,1-2H3 |
| InChIKey | HMPQVCKEXKZNHP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one?
The IUPAC name of 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one (CID 71765113) is 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one.
What is the SMILES notation for 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one?
The canonical SMILES for 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one is COc1ccc(-c2cc(=O)c3cc(N4CCCNCC4)ccc3o2)cc1OC.
What is the InChIKey of 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one?
The InChIKey is HMPQVCKEXKZNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-26-20-6-4-15(12-22(20)27-2)21-14-18(25)17-13-16(5-7-19(17)28-21)24-10-3-8-23-9-11-24/h4-7,12-14,23H,3,8-11H2,1-2H3.
What are the key properties of 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one?
6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one has a molecular weight of 380.44 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one is sourced from PubChem (CID 71765113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).