C22H24N2O4 — CID 71765113
6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one (PubChem CID 71765113) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one.
| Compound Name | 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 71765113 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-(1,4-diazepan-1-yl)-2-(3,4-dimethoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3cc(N4CCCNCC4)ccc3o2)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-26-20-6-4-15(12-22(20)27-2)21-14-18(25)17-13-16(5-7-19(17)28-21)24-10-3-8-23-9-11-24/h4-7,12-14,23H,3,8-11H2,1-2H3 |
| InChIKey | HMPQVCKEXKZNHP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |