C23H26N2O4 — CID 71765112
2-(3,4-dimethoxyphenyl)-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]chromen-4-one (PubChem CID 71765112) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]chromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]chromen-4-one |
|---|---|
| PubChem CID | 71765112 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-[(3S,5R)-3,5-dimethylpiperazin-1-yl]chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3cc(N4C[C@@H](C)N[C@@H](C)C4)ccc3o2)cc1OC |
| InChI | InChI=1S/C23H26N2O4/c1-14-12-25(13-15(2)24-14)17-6-8-20-18(10-17)19(26)11-22(29-20)16-5-7-21(27-3)23(9-16)28-4/h5-11,14-15,24H,12-13H2,1-4H3/t14-,15+ |
| InChIKey | LJAOAVMRGHTDBL-GASCZTMLSA-N |
| XLogP | 3.66 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |