C22H22N4O2 — CID 123614687
6-(3,5-dimethylpiperazin-1-yl)-2-imidazo[1,2-a]pyridin-2-ylchromen-4-one (PubChem CID 123614687) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 6-(3,5-dimethylpiperazin-1-yl)-2-imidazo[1,2-a]pyridin-2-ylchromen-4-one.
| Compound Name | 6-(3,5-dimethylpiperazin-1-yl)-2-imidazo[1,2-a]pyridin-2-ylchromen-4-one |
|---|---|
| PubChem CID | 123614687 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 6-(3,5-dimethylpiperazin-1-yl)-2-imidazo[1,2-a]pyridin-2-ylchromen-4-one |
| SMILES | CC1CN(c2ccc3oc(-c4cn5ccccc5n4)cc(=O)c3c2)CC(C)N1 |
| InChI | InChI=1S/C22H22N4O2/c1-14-11-26(12-15(2)23-14)16-6-7-20-17(9-16)19(27)10-21(28-20)18-13-25-8-4-3-5-22(25)24-18/h3-10,13-15,23H,11-12H2,1-2H3 |
| InChIKey | NYUPWAFNYIVNPO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |