C24H30NO6- — CID 11875871
(2S)-1-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]pyrrolidine-2-carboxylate (PubChem CID 11875871) has the molecular formula C24H30NO6- and a molecular weight of 428.51 g/mol. Its IUPAC name is (2S)-1-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]pyrrolidine-2-carboxylate.
| Compound Name | (2S)-1-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11875871 |
| Molecular Formula | C24H30NO6- |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S)-1-[2-(3-hexyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCc1c(C)c2ccc(OCC(=O)N3CCC[C@H]3C(=O)[O-])c(C)c2oc1=O |
| InChI | InChI=1S/C24H31NO6/c1-4-5-6-7-9-18-15(2)17-11-12-20(16(3)22(17)31-24(18)29)30-14-21(26)25-13-8-10-19(25)23(27)28/h11-12,19H,4-10,13-14H2,1-3H3,(H,27,28)/p-1/t19-/m0/s1 |
| InChIKey | DRRLBGGHLHMLTN-IBGZPJMESA-M |
| XLogP | 2.65 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|