C25H26O5 — CID 1296102
ethyl 3-[7-[(4-ethenylphenyl)methoxy]-4,8-dimethyl-2-oxochromen-3-yl]propanoate (PubChem CID 1296102) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 3-[7-[(4-ethenylphenyl)methoxy]-4,8-dimethyl-2-oxochromen-3-yl]propanoate.
| Compound Name | ethyl 3-[7-[(4-ethenylphenyl)methoxy]-4,8-dimethyl-2-oxochromen-3-yl]propanoate |
|---|---|
| PubChem CID | 1296102 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | ethyl 3-[7-[(4-ethenylphenyl)methoxy]-4,8-dimethyl-2-oxochromen-3-yl]propanoate |
| SMILES | C=Cc1ccc(COc2ccc3c(C)c(CCC(=O)OCC)c(=O)oc3c2C)cc1 |
| InChI | InChI=1S/C25H26O5/c1-5-18-7-9-19(10-8-18)15-29-22-13-11-20-16(3)21(12-14-23(26)28-6-2)25(27)30-24(20)17(22)4/h5,7-11,13H,1,6,12,14-15H2,2-4H3 |
| InChIKey | WHAKVFNUYGQSHE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|