C27H24O5 — CID 71462562
3-[4,8-dimethyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]propanoic acid (PubChem CID 71462562) has the molecular formula C27H24O5 and a molecular weight of 428.48 g/mol. Its IUPAC name is 3-[4,8-dimethyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]propanoic acid.
| Compound Name | 3-[4,8-dimethyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]propanoic acid |
|---|---|
| PubChem CID | 71462562 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-[4,8-dimethyl-2-oxo-7-[(4-phenylphenyl)methoxy]chromen-3-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)c(=O)oc2c(C)c(OCc3ccc(-c4ccccc4)cc3)ccc12 |
| InChI | InChI=1S/C27H24O5/c1-17-22-12-14-24(18(2)26(22)32-27(30)23(17)13-15-25(28)29)31-16-19-8-10-21(11-9-19)20-6-4-3-5-7-20/h3-12,14H,13,15-16H2,1-2H3,(H,28,29) |
| InChIKey | SNFLXKJWJXOLFU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|