C26H24O5 — CID 45271668
methyl 3-[4,8-dimethyl-7-(naphthalen-1-ylmethoxy)-2-oxochromen-3-yl]propanoate (PubChem CID 45271668) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is methyl 3-[4,8-dimethyl-7-(naphthalen-1-ylmethoxy)-2-oxochromen-3-yl]propanoate.
| Compound Name | methyl 3-[4,8-dimethyl-7-(naphthalen-1-ylmethoxy)-2-oxochromen-3-yl]propanoate |
|---|---|
| PubChem CID | 45271668 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | methyl 3-[4,8-dimethyl-7-(naphthalen-1-ylmethoxy)-2-oxochromen-3-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)c2ccc(OCc3cccc4ccccc34)c(C)c2oc1=O |
| InChI | InChI=1S/C26H24O5/c1-16-20-11-13-23(30-15-19-9-6-8-18-7-4-5-10-22(18)19)17(2)25(20)31-26(28)21(16)12-14-24(27)29-3/h4-11,13H,12,14-15H2,1-3H3 |
| InChIKey | MHUKAIBFCFMMCR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|