C21H19IO4 — CID 163862292
7-[(2-iodophenyl)methoxy]-4,8-dimethyl-3-(2-oxopropyl)chromen-2-one (PubChem CID 163862292) has the molecular formula C21H19IO4 and a molecular weight of 462.28 g/mol. Its IUPAC name is 7-[(2-iodophenyl)methoxy]-4,8-dimethyl-3-(2-oxopropyl)chromen-2-one.
| Compound Name | 7-[(2-iodophenyl)methoxy]-4,8-dimethyl-3-(2-oxopropyl)chromen-2-one |
|---|---|
| PubChem CID | 163862292 |
| Molecular Formula | C21H19IO4 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 7-[(2-iodophenyl)methoxy]-4,8-dimethyl-3-(2-oxopropyl)chromen-2-one |
| SMILES | CC(=O)Cc1c(C)c2ccc(OCc3ccccc3I)c(C)c2oc1=O |
| InChI | InChI=1S/C21H19IO4/c1-12(23)10-17-13(2)16-8-9-19(14(3)20(16)26-21(17)24)25-11-15-6-4-5-7-18(15)22/h4-9H,10-11H2,1-3H3 |
| InChIKey | KOBQTGQTCPWYFE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|