C23H21F3O4 — CID 163710421
4,8-dimethyl-7-[[3-methyl-5-(trifluoromethyl)phenyl]methoxy]-3-(2-oxopropyl)chromen-2-one (PubChem CID 163710421) has the molecular formula C23H21F3O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is 4,8-dimethyl-7-[[3-methyl-5-(trifluoromethyl)phenyl]methoxy]-3-(2-oxopropyl)chromen-2-one.
| Compound Name | 4,8-dimethyl-7-[[3-methyl-5-(trifluoromethyl)phenyl]methoxy]-3-(2-oxopropyl)chromen-2-one |
|---|---|
| PubChem CID | 163710421 |
| Molecular Formula | C23H21F3O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4,8-dimethyl-7-[[3-methyl-5-(trifluoromethyl)phenyl]methoxy]-3-(2-oxopropyl)chromen-2-one |
| SMILES | CC(=O)Cc1c(C)c2ccc(OCc3cc(C)cc(C(F)(F)F)c3)c(C)c2oc1=O |
| InChI | InChI=1S/C23H21F3O4/c1-12-7-16(10-17(8-12)23(24,25)26)11-29-20-6-5-18-14(3)19(9-13(2)27)22(28)30-21(18)15(20)4/h5-8,10H,9,11H2,1-4H3 |
| InChIKey | ITKOFQROMAFYEO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|