C18H19O5- — CID 7083781
2-[4,8-dimethyl-7-(3-methylbut-2-enoxy)-2-oxochromen-3-yl]acetate (PubChem CID 7083781) has the molecular formula C18H19O5- and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[4,8-dimethyl-7-(3-methylbut-2-enoxy)-2-oxochromen-3-yl]acetate.
| Compound Name | 2-[4,8-dimethyl-7-(3-methylbut-2-enoxy)-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 7083781 |
| Molecular Formula | C18H19O5- |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[4,8-dimethyl-7-(3-methylbut-2-enoxy)-2-oxochromen-3-yl]acetate |
| SMILES | CC(C)=CCOc1ccc2c(C)c(CC(=O)[O-])c(=O)oc2c1C |
| InChI | InChI=1S/C18H20O5/c1-10(2)7-8-22-15-6-5-13-11(3)14(9-16(19)20)18(21)23-17(13)12(15)4/h5-7H,8-9H2,1-4H3,(H,19,20)/p-1 |
| InChIKey | RYTMCPUAVMNKLA-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|