C24H26O4 — CID 163478234
7-[(2,5-dimethylphenyl)methoxy]-4,8-dimethyl-3-(3-oxobutyl)chromen-2-one (PubChem CID 163478234) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 7-[(2,5-dimethylphenyl)methoxy]-4,8-dimethyl-3-(3-oxobutyl)chromen-2-one.
| Compound Name | 7-[(2,5-dimethylphenyl)methoxy]-4,8-dimethyl-3-(3-oxobutyl)chromen-2-one |
|---|---|
| PubChem CID | 163478234 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 7-[(2,5-dimethylphenyl)methoxy]-4,8-dimethyl-3-(3-oxobutyl)chromen-2-one |
| SMILES | CC(=O)CCc1c(C)c2ccc(OCc3cc(C)ccc3C)c(C)c2oc1=O |
| InChI | InChI=1S/C24H26O4/c1-14-6-7-15(2)19(12-14)13-27-22-11-10-20-17(4)21(9-8-16(3)25)24(26)28-23(20)18(22)5/h6-7,10-12H,8-9,13H2,1-5H3 |
| InChIKey | BYAWBUWCTYNICZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|