C16H18O5 — CID 5417098
ethyl 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoate (PubChem CID 5417098) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoate.
| Compound Name | ethyl 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 5417098 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | ethyl 3-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)propanoate |
| SMILES | CCOC(=O)CCc1c(C)c2ccc(O)c(C)c2oc1=O |
| InChI | InChI=1S/C16H18O5/c1-4-20-14(18)8-6-12-9(2)11-5-7-13(17)10(3)15(11)21-16(12)19/h5,7,17H,4,6,8H2,1-3H3 |
| InChIKey | OQZCNKKWUHVSSP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|