C17H18NO6- — CID 7086909
2-[[(2R)-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate (PubChem CID 7086909) has the molecular formula C17H18NO6- and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-[[(2R)-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate.
| Compound Name | 2-[[(2R)-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate |
|---|---|
| PubChem CID | 7086909 |
| Molecular Formula | C17H18NO6- |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[[(2R)-2-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate |
| SMILES | Cc1c(C)c2ccc(O[C@H](C)C(=O)NCC(=O)[O-])c(C)c2oc1=O |
| InChI | InChI=1S/C17H19NO6/c1-8-9(2)17(22)24-15-10(3)13(6-5-12(8)15)23-11(4)16(21)18-7-14(19)20/h5-6,11H,7H2,1-4H3,(H,18,21)(H,19,20)/p-1/t11-/m1/s1 |
| InChIKey | MUZVWHSGEVFRKG-LLVKDONJSA-M |
| XLogP | 0.35 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|