C19H27N2O4+ — CID 7599873
3-[[(2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]propyl-dimethylazanium (PubChem CID 7599873) has the molecular formula C19H27N2O4+ and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-[[(2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7599873 |
| Molecular Formula | C19H27N2O4+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-[[(2S)-2-(4,8-dimethyl-2-oxochromen-7-yl)oxypropanoyl]amino]propyl-dimethylazanium |
| SMILES | Cc1cc(=O)oc2c(C)c(O[C@@H](C)C(=O)NCCC[NH+](C)C)ccc12 |
| InChI | InChI=1S/C19H26N2O4/c1-12-11-17(22)25-18-13(2)16(8-7-15(12)18)24-14(3)19(23)20-9-6-10-21(4)5/h7-8,11,14H,6,9-10H2,1-5H3,(H,20,23)/p+1/t14-/m0/s1 |
| InChIKey | NCDADOQVULCOLK-AWEZNQCLSA-O |
| XLogP | 0.83 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|