C25H19F3O3 — CID 2064053
8-methyl-3-(2-methylphenyl)-7-phenylmethoxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 2064053) has the molecular formula C25H19F3O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is 8-methyl-3-(2-methylphenyl)-7-phenylmethoxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 8-methyl-3-(2-methylphenyl)-7-phenylmethoxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 2064053 |
| Molecular Formula | C25H19F3O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 8-methyl-3-(2-methylphenyl)-7-phenylmethoxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | Cc1ccccc1-c1c(C(F)(F)F)oc2c(C)c(OCc3ccccc3)ccc2c1=O |
| InChI | InChI=1S/C25H19F3O3/c1-15-8-6-7-11-18(15)21-22(29)19-12-13-20(30-14-17-9-4-3-5-10-17)16(2)23(19)31-24(21)25(26,27)28/h3-13H,14H2,1-2H3 |
| InChIKey | MIAOVSUOHFORTQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |