C12H14N2OS — CID 62082547
4-(2-ethoxyphenyl)-2-methyl-1,3-thiazol-5-amine (PubChem CID 62082547) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-2-methyl-1,3-thiazol-5-amine.
| Compound Name | 4-(2-ethoxyphenyl)-2-methyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 62082547 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(2-ethoxyphenyl)-2-methyl-1,3-thiazol-5-amine |
| SMILES | CCOc1ccccc1-c1nc(C)sc1N |
| InChI | InChI=1S/C12H14N2OS/c1-3-15-10-7-5-4-6-9(10)11-12(13)16-8(2)14-11/h4-7H,3,13H2,1-2H3 |
| InChIKey | GSVRIMGDWGWRGA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |