C12H13NOS — CID 3350660
4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole (PubChem CID 3350660) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole.
| Compound Name | 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 3350660 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(C)sc2C)cc1 |
| InChI | InChI=1S/C12H13NOS/c1-8-12(13-9(2)15-8)10-4-6-11(14-3)7-5-10/h4-7H,1-3H3 |
| InChIKey | WMWODDFXVNHJCO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |