About 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole
4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole (PubChem CID 3350660) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole |
| PubChem CID | 3350660 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(C)sc2C)cc1 |
| InChI | InChI=1S/C12H13NOS/c1-8-12(13-9(2)15-8)10-4-6-11(14-3)7-5-10/h4-7H,1-3H3 |
| InChIKey | WMWODDFXVNHJCO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole?
The IUPAC name of 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole (CID 3350660) is 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole?
The canonical SMILES for 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole is COc1ccc(-c2nc(C)sc2C)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole?
The InChIKey is WMWODDFXVNHJCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS/c1-8-12(13-9(2)15-8)10-4-6-11(14-3)7-5-10/h4-7H,1-3H3.
What are the key properties of 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole?
4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole has a molecular weight of 219.31 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 3350660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).